C13H19FO2S — CID 171807338
2-(2,2-diethoxyethylsulfanyl)-4-fluoro-1-methylbenzene (PubChem CID 171807338) has the molecular formula C13H19FO2S and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylsulfanyl)-4-fluoro-1-methylbenzene.
| Compound Name | 2-(2,2-diethoxyethylsulfanyl)-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 171807338 |
| Molecular Formula | C13H19FO2S |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(2,2-diethoxyethylsulfanyl)-4-fluoro-1-methylbenzene |
| SMILES | CCOC(CSc1cc(F)ccc1C)OCC |
| InChI | InChI=1S/C13H19FO2S/c1-4-15-13(16-5-2)9-17-12-8-11(14)7-6-10(12)3/h6-8,13H,4-5,9H2,1-3H3 |
| InChIKey | SVPCOZKLQLMOOA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|