C16H22O3S — CID 11098407
1-[(R)-[(1Z,3E)-5,5-diethoxypenta-1,3-dienyl]sulfinyl]-4-methylbenzene (PubChem CID 11098407) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-[(R)-[(1Z,3E)-5,5-diethoxypenta-1,3-dienyl]sulfinyl]-4-methylbenzene.
| Compound Name | 1-[(R)-[(1Z,3E)-5,5-diethoxypenta-1,3-dienyl]sulfinyl]-4-methylbenzene |
|---|---|
| PubChem CID | 11098407 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[(R)-[(1Z,3E)-5,5-diethoxypenta-1,3-dienyl]sulfinyl]-4-methylbenzene |
| SMILES | CCOC(/C=C/C=C\[S@@](=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C16H22O3S/c1-4-18-16(19-5-2)8-6-7-13-20(17)15-11-9-14(3)10-12-15/h6-13,16H,4-5H2,1-3H3/b8-6+,13-7-/t20-/m1/s1 |
| InChIKey | KWXVCYZIQVXHHJ-ZRZIAEOFSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|