C13H20O2S — CID 22666466
1-(2,2-diethoxyethylsulfanyl)-3-methylbenzene (PubChem CID 22666466) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(2,2-diethoxyethylsulfanyl)-3-methylbenzene.
| Compound Name | 1-(2,2-diethoxyethylsulfanyl)-3-methylbenzene |
|---|---|
| PubChem CID | 22666466 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(2,2-diethoxyethylsulfanyl)-3-methylbenzene |
| SMILES | CCOC(CSc1cccc(C)c1)OCC |
| InChI | InChI=1S/C13H20O2S/c1-4-14-13(15-5-2)10-16-12-8-6-7-11(3)9-12/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | NYLOSPOOCOREQT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|