C13H17ClO2S — CID 10540156
1-chloro-4-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylbenzene (PubChem CID 10540156) has the molecular formula C13H17ClO2S and a molecular weight of 272.80 g/mol. Its IUPAC name is 1-chloro-4-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10540156 |
| Molecular Formula | C13H17ClO2S |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-chloro-4-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylbenzene |
| SMILES | COC(/C=C(\C)CSc1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C13H17ClO2S/c1-10(8-13(15-2)16-3)9-17-12-6-4-11(14)5-7-12/h4-8,13H,9H2,1-3H3/b10-8+ |
| InChIKey | DRWUSJFQKTUIBA-CSKARUKUSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|