C15H17ClO2S — CID 15201223
methyl (2E,4E)-6-(4-chlorophenyl)sulfanyl-4,5-dimethylhexa-2,4-dienoate (PubChem CID 15201223) has the molecular formula C15H17ClO2S and a molecular weight of 296.82 g/mol. Its IUPAC name is methyl (2E,4E)-6-(4-chlorophenyl)sulfanyl-4,5-dimethylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4E)-6-(4-chlorophenyl)sulfanyl-4,5-dimethylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 15201223 |
| Molecular Formula | C15H17ClO2S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | methyl (2E,4E)-6-(4-chlorophenyl)sulfanyl-4,5-dimethylhexa-2,4-dienoate |
| SMILES | COC(=O)/C=C/C(C)=C(\C)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO2S/c1-11(4-9-15(17)18-3)12(2)10-19-14-7-5-13(16)6-8-14/h4-9H,10H2,1-3H3/b9-4+,12-11+ |
| InChIKey | JNCILMJXNXMWEE-AAFJOEHWSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|