C13H18O2S — CID 134986391
(4S)-2,2,4-trimethyl-6-phenylsulfanyl-1,3-dioxane (PubChem CID 134986391) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (4S)-2,2,4-trimethyl-6-phenylsulfanyl-1,3-dioxane.
| Compound Name | (4S)-2,2,4-trimethyl-6-phenylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 134986391 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (4S)-2,2,4-trimethyl-6-phenylsulfanyl-1,3-dioxane |
| SMILES | C[C@H]1CC(Sc2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C13H18O2S/c1-10-9-12(15-13(2,3)14-10)16-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3/t10-,12?/m0/s1 |
| InChIKey | AVBQOJZQGOZPPF-NUHJPDEHSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |