C17H24O5S — CID 135011201
methyl (Z)-5,7,7-trimethoxy-3-phenylsulfanylhept-2-enoate (PubChem CID 135011201) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is methyl (Z)-5,7,7-trimethoxy-3-phenylsulfanylhept-2-enoate.
| Compound Name | methyl (Z)-5,7,7-trimethoxy-3-phenylsulfanylhept-2-enoate |
|---|---|
| PubChem CID | 135011201 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | methyl (Z)-5,7,7-trimethoxy-3-phenylsulfanylhept-2-enoate |
| SMILES | COC(=O)/C=C(/CC(CC(OC)OC)OC)Sc1ccccc1 |
| InChI | InChI=1S/C17H24O5S/c1-19-13(11-17(21-3)22-4)10-15(12-16(18)20-2)23-14-8-6-5-7-9-14/h5-9,12-13,17H,10-11H2,1-4H3/b15-12- |
| InChIKey | DLJPVBOQMZAJKI-QINSGFPZSA-N |
| XLogP | 3.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|