C16H18O5S — CID 135022433
[(3S,6S)-3-acetyloxy-6-phenylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 135022433) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is [(3S,6S)-3-acetyloxy-6-phenylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-3-acetyloxy-6-phenylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135022433 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [(3S,6S)-3-acetyloxy-6-phenylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Sc2ccccc2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H18O5S/c1-11(17)19-10-15-14(20-12(2)18)8-9-16(21-15)22-13-6-4-3-5-7-13/h3-9,14-16H,10H2,1-2H3/t14-,15?,16-/m0/s1 |
| InChIKey | CPPQXIRWLOCYDE-AQOJYXMDSA-N |
| XLogP | 2.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|