C17H28OS — CID 85090306
[(5S,6R)-6-methoxydecan-5-yl]sulfanylbenzene (PubChem CID 85090306) has the molecular formula C17H28OS and a molecular weight of 280.48 g/mol. Its IUPAC name is [(5S,6R)-6-methoxydecan-5-yl]sulfanylbenzene.
| Compound Name | [(5S,6R)-6-methoxydecan-5-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 85090306 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [(5S,6R)-6-methoxydecan-5-yl]sulfanylbenzene |
| SMILES | CCCC[C@H](Sc1ccccc1)[C@@H](CCCC)OC |
| InChI | InChI=1S/C17H28OS/c1-4-6-13-16(18-3)17(14-7-5-2)19-15-11-9-8-10-12-15/h8-12,16-17H,4-7,13-14H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | ZHOGYGDQLHGOGZ-SJORKVTESA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |