C17H26O2S — CID 10266477
(2S,4S,6S)-4-hexyl-2-methyl-6-phenylsulfanyl-1,3-dioxane (PubChem CID 10266477) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is (2S,4S,6S)-4-hexyl-2-methyl-6-phenylsulfanyl-1,3-dioxane.
| Compound Name | (2S,4S,6S)-4-hexyl-2-methyl-6-phenylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 10266477 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S,4S,6S)-4-hexyl-2-methyl-6-phenylsulfanyl-1,3-dioxane |
| SMILES | CCCCCC[C@H]1C[C@H](Sc2ccccc2)O[C@@H](C)O1 |
| InChI | InChI=1S/C17H26O2S/c1-3-4-5-7-10-15-13-17(19-14(2)18-15)20-16-11-8-6-9-12-16/h6,8-9,11-12,14-15,17H,3-5,7,10,13H2,1-2H3/t14-,15-,17-/m0/s1 |
| InChIKey | QLNKZZUEAYXUGB-ZOBUZTSGSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|