C27H50O3S2Si2 — CID 10076032
tert-butyl-dimethyl-[(3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butoxy]silane (PubChem CID 10076032) has the molecular formula C27H50O3S2Si2 and a molecular weight of 543.00 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butoxy]silane |
|---|---|
| PubChem CID | 10076032 |
| Molecular Formula | C27H50O3S2Si2 |
| Molecular Weight | 543.00 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | tert-butyl-dimethyl-[(3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](C[C@@]1(Sc2ccccc2)CCCCS1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C27H50O3S2Si2/c1-26(2,3)34(7,8)30-18-16-24(29-23-28-19-21-33(4,5)6)22-27(17-12-13-20-31-27)32-25-14-10-9-11-15-25/h9-11,14-15,24H,12-13,16-23H2,1-8H3/t24-,27+/m1/s1 |
| InChIKey | PLRIZWPJORYESF-SQHAQQRYSA-N |
| XLogP | 8.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|