C35H64O6S2Si2 — CID 135022781
tert-butyl-[(3R,4R,6R)-3-[(2R,5R,6S)-5-(methoxymethoxy)-6-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane (PubChem CID 135022781) has the molecular formula C35H64O6S2Si2 and a molecular weight of 701.20 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,6R)-3-[(2R,5R,6S)-5-(methoxymethoxy)-6-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,6R)-3-[(2R,5R,6S)-5-(methoxymethoxy)-6-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135022781 |
| Molecular Formula | C35H64O6S2Si2 |
| Molecular Weight | 701.20 g/mol |
| Exact Mass | 700.37 |
| IUPAC Name | tert-butyl-[(3R,4R,6R)-3-[(2R,5R,6S)-5-(methoxymethoxy)-6-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]sulfanyl-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane |
| SMILES | COCO[C@H]1C(O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](S[C@@H]2C(C)O[C@H](Sc3ccccc3)C[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H]1C |
| InChI | InChI=1S/C35H64O6S2Si2/c1-23(2)45(24(3)4,25(5)6)41-29-20-32(38-26(7)33(29)37-22-36-12)43-34-27(8)39-31(42-28-18-16-15-17-19-28)21-30(34)40-44(13,14)35(9,10)11/h15-19,23-27,29-34H,20-22H2,1-14H3/t26-,27?,29?,30+,31+,32+,33+,34+/m0/s1 |
| InChIKey | HOEUUTAAFBFRLK-NTHJAMIVSA-N |
| XLogP | 10.09 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.20 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|