C21H36O2S2Si — CID 10001754
(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-2-phenylsulfanylthian-2-yl]butan-2-ol (PubChem CID 10001754) has the molecular formula C21H36O2S2Si and a molecular weight of 412.74 g/mol. Its IUPAC name is (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-2-phenylsulfanylthian-2-yl]butan-2-ol.
| Compound Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-2-phenylsulfanylthian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 10001754 |
| Molecular Formula | C21H36O2S2Si |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-2-phenylsulfanylthian-2-yl]butan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](O)C[C@@]1(Sc2ccccc2)CCCCS1 |
| InChI | InChI=1S/C21H36O2S2Si/c1-20(2,3)26(4,5)23-15-13-18(22)17-21(14-9-10-16-24-21)25-19-11-7-6-8-12-19/h6-8,11-12,18,22H,9-10,13-17H2,1-5H3/t18-,21+/m1/s1 |
| InChIKey | GNMCODNBSVZAST-NQIIRXRSSA-N |
| XLogP | 6.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|