C33H54O2S2Si — CID 59053274
(E,2R)-1-[2-[(2R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylocta-4,7-dienyl]-1,3-dithian-2-yl]-5-methyl-7-phenylhept-5-en-2-ol (PubChem CID 59053274) has the molecular formula C33H54O2S2Si and a molecular weight of 575.01 g/mol. Its IUPAC name is (E,2R)-1-[2-[(2R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylocta-4,7-dienyl]-1,3-dithian-2-yl]-5-methyl-7-phenylhept-5-en-2-ol.
| Compound Name | (E,2R)-1-[2-[(2R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylocta-4,7-dienyl]-1,3-dithian-2-yl]-5-methyl-7-phenylhept-5-en-2-ol |
|---|---|
| PubChem CID | 59053274 |
| Molecular Formula | C33H54O2S2Si |
| Molecular Weight | 575.01 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | (E,2R)-1-[2-[(2R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylocta-4,7-dienyl]-1,3-dithian-2-yl]-5-methyl-7-phenylhept-5-en-2-ol |
| SMILES | C=CC/C=C(\C)C[C@H](CC1(C[C@H](O)CC/C(C)=C/Cc2ccccc2)SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H54O2S2Si/c1-9-10-15-28(3)24-31(35-38(7,8)32(4,5)6)26-33(36-22-14-23-37-33)25-30(34)21-19-27(2)18-20-29-16-12-11-13-17-29/h9,11-13,15-18,30-31,34H,1,10,14,19-26H2,2-8H3/b27-18+,28-15+/t30-,31-/m1/s1 |
| InChIKey | VMMNCNWPAVKVNX-COPKWONSSA-N |
| XLogP | 9.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.01 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|