C18H30OS2Si — CID 135019439
tert-butyl-[(1R)-2-(1,3-dithian-2-yl)-1-phenylethoxy]-dimethylsilane (PubChem CID 135019439) has the molecular formula C18H30OS2Si and a molecular weight of 354.66 g/mol. Its IUPAC name is tert-butyl-[(1R)-2-(1,3-dithian-2-yl)-1-phenylethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-2-(1,3-dithian-2-yl)-1-phenylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135019439 |
| Molecular Formula | C18H30OS2Si |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | tert-butyl-[(1R)-2-(1,3-dithian-2-yl)-1-phenylethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC1SCCCS1)c1ccccc1 |
| InChI | InChI=1S/C18H30OS2Si/c1-18(2,3)22(4,5)19-16(15-10-7-6-8-11-15)14-17-20-12-9-13-21-17/h6-8,10-11,16-17H,9,12-14H2,1-5H3/t16-/m1/s1 |
| InChIKey | WEHQYHPOSJUERZ-MRXNPFEDSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|