About 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline
3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline (PubChem CID 11266223) has the molecular formula C18H28OSi
and a molecular weight of 288.51 g/mol. Its IUPAC name is 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline.
Molecular Properties
| Compound Name | 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline |
| PubChem CID | 11266223 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline |
| SMILES | CCCCCCC1=CCC(c2ccccc2)O[Si]1(C)C |
| InChI | InChI=1S/C18H28OSi/c1-4-5-6-10-13-17-14-15-18(19-20(17,2)3)16-11-8-7-9-12-16/h7-9,11-12,14,18H,4-6,10,13,15H2,1-3H3 |
| InChIKey | GHLFGEUVTYCMLO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline?
The IUPAC name of 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline (CID 11266223) is 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline.
What is the SMILES notation for 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline?
The canonical SMILES for 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline is CCCCCCC1=CCC(c2ccccc2)O[Si]1(C)C.
What is the InChIKey of 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline?
The InChIKey is GHLFGEUVTYCMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28OSi/c1-4-5-6-10-13-17-14-15-18(19-20(17,2)3)16-11-8-7-9-12-16/h7-9,11-12,14,18H,4-6,10,13,15H2,1-3H3.
What are the key properties of 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline?
3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline has a molecular weight of 288.51 g/mol, XLogP of 5.79, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-2,2-dimethyl-6-phenyl-5,6-dihydrooxasiline is sourced from PubChem (CID 11266223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).