C29H44O3S2Si — CID 135011295
(2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-1,3-dithian-2-yl]-4-phenylmethoxybutan-2-ol (PubChem CID 135011295) has the molecular formula C29H44O3S2Si and a molecular weight of 532.89 g/mol. Its IUPAC name is (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-1,3-dithian-2-yl]-4-phenylmethoxybutan-2-ol.
| Compound Name | (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-1,3-dithian-2-yl]-4-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 135011295 |
| Molecular Formula | C29H44O3S2Si |
| Molecular Weight | 532.89 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-1,3-dithian-2-yl]-4-phenylmethoxybutan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC1(C[C@H](O)CCOCc2ccccc2)SCCCS1)c1ccccc1 |
| InChI | InChI=1S/C29H44O3S2Si/c1-28(2,3)35(4,5)32-27(25-15-10-7-11-16-25)22-29(33-19-12-20-34-29)21-26(30)17-18-31-23-24-13-8-6-9-14-24/h6-11,13-16,26-27,30H,12,17-23H2,1-5H3/t26-,27+/m1/s1 |
| InChIKey | JHTBYWICQCMKPO-SXOMAYOGSA-N |
| XLogP | 8.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.89 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|