C30H44O4S2Si — CID 10875413
(8S,9S,10R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-ol (PubChem CID 10875413) has the molecular formula C30H44O4S2Si and a molecular weight of 560.90 g/mol. Its IUPAC name is (8S,9S,10R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-ol.
| Compound Name | (8S,9S,10R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-ol |
|---|---|
| PubChem CID | 10875413 |
| Molecular Formula | C30H44O4S2Si |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (8S,9S,10R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2(C[C@H](O)[C@@H](OCc3ccccc3)[C@@H]1OCc1ccccc1)SCCCS2 |
| InChI | InChI=1S/C30H44O4S2Si/c1-29(2,3)37(4,5)34-26-20-30(35-17-12-18-36-30)19-25(31)27(32-21-23-13-8-6-9-14-23)28(26)33-22-24-15-10-7-11-16-24/h6-11,13-16,25-28,31H,12,17-22H2,1-5H3/t25-,26-,27+,28+/m0/s1 |
| InChIKey | YHKUWXGLDBCAAV-YVHASNINSA-N |
| XLogP | 7.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|