C45H76O6S4Si2 — CID 10898251
(2S,4S)-1,5-bis[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]pentane-2,4-diol (PubChem CID 10898251) has the molecular formula C45H76O6S4Si2 and a molecular weight of 897.54 g/mol. Its IUPAC name is (2S,4S)-1,5-bis[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]pentane-2,4-diol.
| Compound Name | (2S,4S)-1,5-bis[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]pentane-2,4-diol |
|---|---|
| PubChem CID | 10898251 |
| Molecular Formula | C45H76O6S4Si2 |
| Molecular Weight | 897.54 g/mol |
| Exact Mass | 896.41 |
| IUPAC Name | (2S,4S)-1,5-bis[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]pentane-2,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](COCc1ccccc1)CC1(C[C@@H](O)C[C@H](O)CC2(C[C@H](COCc3ccccc3)O[Si](C)(C)C(C)(C)C)SCCCS2)SCCCS1 |
| InChI | InChI=1S/C45H76O6S4Si2/c1-42(2,3)56(7,8)50-40(34-48-32-36-19-13-11-14-20-36)30-44(52-23-17-24-53-44)28-38(46)27-39(47)29-45(54-25-18-26-55-45)31-41(51-57(9,10)43(4,5)6)35-49-33-37-21-15-12-16-22-37/h11-16,19-22,38-41,46-47H,17-18,23-35H2,1-10H3/t38-,39-,40+,41+/m0/s1 |
| InChIKey | OMNBCNOWLGWIRO-LETRWZBTSA-N |
| XLogP | 12.01 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.54 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|