C26H38O4S2Si — CID 11145605
(1R,2R,3S,4R)-6,6-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)-4-trimethylsilyloxycycloheptan-1-ol (PubChem CID 11145605) has the molecular formula C26H38O4S2Si and a molecular weight of 506.81 g/mol. Its IUPAC name is (1R,2R,3S,4R)-6,6-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)-4-trimethylsilyloxycycloheptan-1-ol.
| Compound Name | (1R,2R,3S,4R)-6,6-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)-4-trimethylsilyloxycycloheptan-1-ol |
|---|---|
| PubChem CID | 11145605 |
| Molecular Formula | C26H38O4S2Si |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (1R,2R,3S,4R)-6,6-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)-4-trimethylsilyloxycycloheptan-1-ol |
| SMILES | CSC1(SC)C[C@@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C26H38O4S2Si/c1-31-26(32-2)16-22(27)24(28-18-20-12-8-6-9-13-20)25(23(17-26)30-33(3,4)5)29-19-21-14-10-7-11-15-21/h6-15,22-25,27H,16-19H2,1-5H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | GUKLDIJPKCRTBY-ZGFBMJKBSA-N |
| XLogP | 5.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|