C30H34O4S2 — CID 11548163
(2R,3R,4R)-5-(1,3-dithian-2-ylidene)-1,3,4-tris(phenylmethoxy)pentan-2-ol (PubChem CID 11548163) has the molecular formula C30H34O4S2 and a molecular weight of 522.73 g/mol. Its IUPAC name is (2R,3R,4R)-5-(1,3-dithian-2-ylidene)-1,3,4-tris(phenylmethoxy)pentan-2-ol.
| Compound Name | (2R,3R,4R)-5-(1,3-dithian-2-ylidene)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 11548163 |
| Molecular Formula | C30H34O4S2 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (2R,3R,4R)-5-(1,3-dithian-2-ylidene)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
| SMILES | O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=C1SCCCS1)OCc1ccccc1 |
| InChI | InChI=1S/C30H34O4S2/c31-27(23-32-20-24-11-4-1-5-12-24)30(34-22-26-15-8-3-9-16-26)28(19-29-35-17-10-18-36-29)33-21-25-13-6-2-7-14-25/h1-9,11-16,19,27-28,30-31H,10,17-18,20-23H2/t27-,28-,30-/m1/s1 |
| InChIKey | WNAAPOOTXXUYQH-MUPNOLHXSA-N |
| XLogP | 6.45 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |