C17H26O4S2 — CID 44588353
[(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-methoxy-2-phenyl-1,3-dioxan-4-yl]methanol (PubChem CID 44588353) has the molecular formula C17H26O4S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is [(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-methoxy-2-phenyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-methoxy-2-phenyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 44588353 |
| Molecular Formula | C17H26O4S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-methoxy-2-phenyl-1,3-dioxan-4-yl]methanol |
| SMILES | CCSC(SCC)[C@@H]1O[C@H](c2ccccc2)O[C@H](CO)[C@@H]1OC |
| InChI | InChI=1S/C17H26O4S2/c1-4-22-17(23-5-2)15-14(19-3)13(11-18)20-16(21-15)12-9-7-6-8-10-12/h6-10,13-18H,4-5,11H2,1-3H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | NRKSQPAOMKCPIY-QKPAOTATSA-N |
| XLogP | 3.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|