C22H28O4S — CID 11406606
(2S,3R,4S,5S,6S)-2-ethylsulfanyl-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 11406606) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-ethylsulfanyl-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | (2S,3R,4S,5S,6S)-2-ethylsulfanyl-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 11406606 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-ethylsulfanyl-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | CCS[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C22H28O4S/c1-3-27-22-19(23)21(25-15-18-12-8-5-9-13-18)20(16(2)26-22)24-14-17-10-6-4-7-11-17/h4-13,16,19-23H,3,14-15H2,1-2H3/t16-,19+,20-,21-,22-/m0/s1 |
| InChIKey | GFUOWSUGSKLNRX-ODQRPKBASA-N |
| XLogP | 4.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |