C27H46O5S2Si — CID 11168727
(Z)-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-methylsulfanyl-4-methylsulfinyl-7-phenylmethoxyhept-1-en-3-ol (PubChem CID 11168727) has the molecular formula C27H46O5S2Si and a molecular weight of 542.88 g/mol. Its IUPAC name is (Z)-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-methylsulfanyl-4-methylsulfinyl-7-phenylmethoxyhept-1-en-3-ol.
| Compound Name | (Z)-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-methylsulfanyl-4-methylsulfinyl-7-phenylmethoxyhept-1-en-3-ol |
|---|---|
| PubChem CID | 11168727 |
| Molecular Formula | C27H46O5S2Si |
| Molecular Weight | 542.88 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (Z)-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]-4-methylsulfanyl-4-methylsulfinyl-7-phenylmethoxyhept-1-en-3-ol |
| SMILES | CSC(CCCOCc1ccccc1)(C(O)/C=C\[C@H]1OCCC[C@@H]1O[Si](C)(C)C(C)(C)C)S(C)=O |
| InChI | InChI=1S/C27H46O5S2Si/c1-26(2,3)35(6,7)32-24-15-11-20-31-23(24)16-17-25(28)27(33-4,34(5)29)18-12-19-30-21-22-13-9-8-10-14-22/h8-10,13-14,16-17,23-25,28H,11-12,15,18-21H2,1-7H3/b17-16-/t23-,24+,25?,27?,34?/m1/s1 |
| InChIKey | XVWLLRQYESBKQV-OTBZGVPLSA-N |
| XLogP | 5.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|