C30H52O3S2Si2 — CID 135010399
(2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 135010399) has the molecular formula C30H52O3S2Si2 and a molecular weight of 581.05 g/mol. Its IUPAC name is (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 135010399 |
| Molecular Formula | C30H52O3S2Si2 |
| Molecular Weight | 581.05 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCCOCc1ccccc1)CC1(C[C@H](O)CC#C[Si](C)(C)C)SCCCS1 |
| InChI | InChI=1S/C30H52O3S2Si2/c1-29(2,3)37(7,8)33-28(18-12-19-32-25-26-15-10-9-11-16-26)24-30(34-20-14-21-35-30)23-27(31)17-13-22-36(4,5)6/h9-11,15-16,27-28,31H,12,14,17-21,23-25H2,1-8H3/t27-,28+/m1/s1 |
| InChIKey | RPBRLYQRVLBCOG-IZLXSDGUSA-N |
| XLogP | 8.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.05 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|