C33H60O3S2Si2 — CID 59051918
tert-butyl-[(4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentoxy]-dimethylsilane (PubChem CID 59051918) has the molecular formula C33H60O3S2Si2 and a molecular weight of 625.15 g/mol. Its IUPAC name is tert-butyl-[(4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59051918 |
| Molecular Formula | C33H60O3S2Si2 |
| Molecular Weight | 625.15 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | tert-butyl-[(4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentoxy]-dimethylsilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1(C[C@H](CCCO[Si](C)(C)C(C)(C)C)OCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C33H60O3S2Si2/c1-13-30(36-40(11,12)32(6,7)8)27(2)33(37-23-18-24-38-33)25-29(34-26-28-19-15-14-16-20-28)21-17-22-35-39(9,10)31(3,4)5/h13-16,19-20,27,29-30H,1,17-18,21-26H2,2-12H3/t27-,29+,30+/m1/s1 |
| InChIKey | QPGSSXOYNWWSMP-GGCFSWKVSA-N |
| XLogP | 10.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.15 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|