C34H64O5S2Si2 — CID 11169848
tert-butyl-[(1S,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-(1,3-dithian-2-yl)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-2-methylhexoxy]-dimethylsilane (PubChem CID 11169848) has the molecular formula C34H64O5S2Si2 and a molecular weight of 673.19 g/mol. Its IUPAC name is tert-butyl-[(1S,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-(1,3-dithian-2-yl)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-2-methylhexoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-(1,3-dithian-2-yl)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-2-methylhexoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11169848 |
| Molecular Formula | C34H64O5S2Si2 |
| Molecular Weight | 673.19 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | tert-butyl-[(1S,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-(1,3-dithian-2-yl)ethyl]-6-methoxy-5-[(4-methoxyphenyl)methoxy]-2-methylhexoxy]-dimethylsilane |
| SMILES | COC[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1SCCCS1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C34H64O5S2Si2/c1-25(31(39-43(13,14)34(6,7)8)26(2)32-40-20-15-21-41-32)30(38-42(11,12)33(3,4)5)22-29(24-35-9)37-23-27-16-18-28(36-10)19-17-27/h16-19,25-26,29-32H,15,20-24H2,1-14H3/t25-,26+,29+,30+,31-/m0/s1 |
| InChIKey | CEEWWTKWCUNGML-WAKBFPNISA-N |
| XLogP | 9.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.19 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|