C32H56O7S2Si — CID 10908404
(2S)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]-1,3-dithian-2-yl]-4-[(3,4-dimethoxyphenyl)methoxy]butan-2-ol (PubChem CID 10908404) has the molecular formula C32H56O7S2Si and a molecular weight of 645.01 g/mol. Its IUPAC name is (2S)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]-1,3-dithian-2-yl]-4-[(3,4-dimethoxyphenyl)methoxy]butan-2-ol.
| Compound Name | (2S)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]-1,3-dithian-2-yl]-4-[(3,4-dimethoxyphenyl)methoxy]butan-2-ol |
|---|---|
| PubChem CID | 10908404 |
| Molecular Formula | C32H56O7S2Si |
| Molecular Weight | 645.01 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | (2S)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpropyl]-1,3-dithian-2-yl]-4-[(3,4-dimethoxyphenyl)methoxy]butan-2-ol |
| SMILES | COc1ccc(COCC[C@H](O)CC2(C[C@](C)(C[C@@H]3COC(C)(C)O3)O[Si](C)(C)C(C)(C)C)SCCCS2)cc1OC |
| InChI | InChI=1S/C32H56O7S2Si/c1-29(2,3)42(9,10)39-31(6,20-26-22-37-30(4,5)38-26)23-32(40-16-11-17-41-32)19-25(33)14-15-36-21-24-12-13-27(34-7)28(18-24)35-8/h12-13,18,25-26,33H,11,14-17,19-23H2,1-10H3/t25-,26+,31-/m0/s1 |
| InChIKey | LZEVAKYBIRZCTE-HEHLMWRFSA-N |
| XLogP | 7.64 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.01 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|