C31H58O5S2Si2 — CID 134955083
(2S)-1-[2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1,3-dithian-2-yl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 134955083) has the molecular formula C31H58O5S2Si2 and a molecular weight of 631.11 g/mol. Its IUPAC name is (2S)-1-[2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1,3-dithian-2-yl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2S)-1-[2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1,3-dithian-2-yl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 134955083 |
| Molecular Formula | C31H58O5S2Si2 |
| Molecular Weight | 631.11 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | (2S)-1-[2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1,3-dithian-2-yl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1ccc(COC[C@@H](O)CC2(C[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)SCCCS2)cc1 |
| InChI | InChI=1S/C31H58O5S2Si2/c1-29(2,3)39(8,9)35-18-17-28(36-40(10,11)30(4,5)6)22-31(37-19-12-20-38-31)21-26(32)24-34-23-25-13-15-27(33-7)16-14-25/h13-16,26,28,32H,12,17-24H2,1-11H3/t26-,28-/m0/s1 |
| InChIKey | NROCDVSAABQRQP-XCZPVHLTSA-N |
| XLogP | 8.72 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.11 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|