C38H70O6Si2 — CID 134941539
(2E,5R,6S,7R,8Z)-5-[(4-methoxyphenyl)methoxy]-6,8-dimethyl-7,10-bis[tri(propan-2-yl)silyloxy]deca-2,8-diene-1,4-diol (PubChem CID 134941539) has the molecular formula C38H70O6Si2 and a molecular weight of 679.14 g/mol. Its IUPAC name is (2E,5R,6S,7R,8Z)-5-[(4-methoxyphenyl)methoxy]-6,8-dimethyl-7,10-bis[tri(propan-2-yl)silyloxy]deca-2,8-diene-1,4-diol.
| Compound Name | (2E,5R,6S,7R,8Z)-5-[(4-methoxyphenyl)methoxy]-6,8-dimethyl-7,10-bis[tri(propan-2-yl)silyloxy]deca-2,8-diene-1,4-diol |
|---|---|
| PubChem CID | 134941539 |
| Molecular Formula | C38H70O6Si2 |
| Molecular Weight | 679.14 g/mol |
| Exact Mass | 678.47 |
| IUPAC Name | (2E,5R,6S,7R,8Z)-5-[(4-methoxyphenyl)methoxy]-6,8-dimethyl-7,10-bis[tri(propan-2-yl)silyloxy]deca-2,8-diene-1,4-diol |
| SMILES | COc1ccc(CO[C@@H](C(O)/C=C/CO)[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C\CO[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C38H70O6Si2/c1-26(2)45(27(3)4,28(5)6)43-24-22-32(13)37(44-46(29(7)8,30(9)10)31(11)12)33(14)38(36(40)17-16-23-39)42-25-34-18-20-35(41-15)21-19-34/h16-22,26-31,33,36-40H,23-25H2,1-15H3/b17-16+,32-22-/t33-,36?,37+,38-/m1/s1 |
| InChIKey | LAWDWKUDYGDREA-QVULXPKSSA-N |
| XLogP | 9.82 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.14 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|