C26H38O5S2 — CID 11386381
(2S,4R,6R,15R)-4-[(4-methoxyphenyl)methoxymethyl]-15-(2-methylidenebutyl)-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol (PubChem CID 11386381) has the molecular formula C26H38O5S2 and a molecular weight of 494.72 g/mol. Its IUPAC name is (2S,4R,6R,15R)-4-[(4-methoxyphenyl)methoxymethyl]-15-(2-methylidenebutyl)-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol.
| Compound Name | (2S,4R,6R,15R)-4-[(4-methoxyphenyl)methoxymethyl]-15-(2-methylidenebutyl)-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol |
|---|---|
| PubChem CID | 11386381 |
| Molecular Formula | C26H38O5S2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (2S,4R,6R,15R)-4-[(4-methoxyphenyl)methoxymethyl]-15-(2-methylidenebutyl)-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol |
| SMILES | C=C(CC)C[C@@H]1CC2(C[C@]3(C[C@@H](O)C[C@H](COCc4ccc(OC)cc4)O3)O1)SCCCS2 |
| InChI | InChI=1S/C26H38O5S2/c1-4-19(2)12-23-15-26(32-10-5-11-33-26)18-25(30-23)14-21(27)13-24(31-25)17-29-16-20-6-8-22(28-3)9-7-20/h6-9,21,23-24,27H,2,4-5,10-18H2,1,3H3/t21-,23+,24+,25+/m0/s1 |
| InChIKey | KDONJHNPWFWZMU-KVZCNWPJSA-N |
| XLogP | 5.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|