C26H36F2O4S2 — CID 91092890
2-(4-ethoxy-2,3-difluorophenyl)-5-[5-[(2S)-5-pent-3-enyloxan-2-yl]-1,3-dithian-2-yl]-1,3-dioxane (PubChem CID 91092890) has the molecular formula C26H36F2O4S2 and a molecular weight of 514.70 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-difluorophenyl)-5-[5-[(2S)-5-pent-3-enyloxan-2-yl]-1,3-dithian-2-yl]-1,3-dioxane.
| Compound Name | 2-(4-ethoxy-2,3-difluorophenyl)-5-[5-[(2S)-5-pent-3-enyloxan-2-yl]-1,3-dithian-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 91092890 |
| Molecular Formula | C26H36F2O4S2 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-(4-ethoxy-2,3-difluorophenyl)-5-[5-[(2S)-5-pent-3-enyloxan-2-yl]-1,3-dithian-2-yl]-1,3-dioxane |
| SMILES | CC=CCCC1CC[C@@H](C2CSC(C3COC(c4ccc(OCC)c(F)c4F)OC3)SC2)OC1 |
| InChI | InChI=1S/C26H36F2O4S2/c1-3-5-6-7-17-8-10-21(30-12-17)19-15-33-26(34-16-19)18-13-31-25(32-14-18)20-9-11-22(29-4-2)24(28)23(20)27/h3,5,9,11,17-19,21,25-26H,4,6-8,10,12-16H2,1-2H3/t17?,18?,19?,21-,25?,26?/m0/s1 |
| InChIKey | UMMJDNSKQDHPMY-SPLAGVJDSA-N |
| XLogP | 6.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|