C25H34F2O5 — CID 20621793
2-(4-ethoxy-2,3-difluorophenyl)-5-[4-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]-1,3-dioxane (PubChem CID 20621793) has the molecular formula C25H34F2O5 and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-difluorophenyl)-5-[4-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-(4-ethoxy-2,3-difluorophenyl)-5-[4-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20621793 |
| Molecular Formula | C25H34F2O5 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-(4-ethoxy-2,3-difluorophenyl)-5-[4-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(C2CCC(C3COC(c4ccc(OCC)c(F)c4F)OC3)CC2)OC1 |
| InChI | InChI=1S/C25H34F2O5/c1-3-5-16-12-29-24(30-13-16)18-8-6-17(7-9-18)19-14-31-25(32-15-19)20-10-11-21(28-4-2)23(27)22(20)26/h3,5,10-11,16-19,24-25H,4,6-9,12-15H2,1-2H3/b5-3+ |
| InChIKey | STPDAZVJTTZEMH-HWKANZROSA-N |
| XLogP | 5.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|