C26H28F4O4 — CID 90929857
5-[(6S)-6-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-3-yl]-2-prop-1-enyl-1,3-dioxane (PubChem CID 90929857) has the molecular formula C26H28F4O4 and a molecular weight of 480.50 g/mol. Its IUPAC name is 5-[(6S)-6-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-3-yl]-2-prop-1-enyl-1,3-dioxane.
| Compound Name | 5-[(6S)-6-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-3-yl]-2-prop-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 90929857 |
| Molecular Formula | C26H28F4O4 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 5-[(6S)-6-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-3-yl]-2-prop-1-enyl-1,3-dioxane |
| SMILES | CC=CC1OCC(C2CC[C@@H](c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)OC2)CO1 |
| InChI | InChI=1S/C26H28F4O4/c1-3-5-22-33-13-16(14-34-22)15-6-10-20(32-12-15)19-8-7-17(23(27)25(19)29)18-9-11-21(31-4-2)26(30)24(18)28/h3,5,7-9,11,15-16,20,22H,4,6,10,12-14H2,1-2H3/t15?,16?,20-,22?/m0/s1 |
| InChIKey | JBYQMWQMHBJHJV-XZSWLIDSSA-N |
| XLogP | 6.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|