C18H24F2O2 — CID 176777875
2-(4-ethoxy-2,3-difluorophenyl)-5-[(E)-pent-3-enyl]oxane (PubChem CID 176777875) has the molecular formula C18H24F2O2 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-difluorophenyl)-5-[(E)-pent-3-enyl]oxane.
| Compound Name | 2-(4-ethoxy-2,3-difluorophenyl)-5-[(E)-pent-3-enyl]oxane |
|---|---|
| PubChem CID | 176777875 |
| Molecular Formula | C18H24F2O2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-(4-ethoxy-2,3-difluorophenyl)-5-[(E)-pent-3-enyl]oxane |
| SMILES | C/C=C/CCC1CCC(c2ccc(OCC)c(F)c2F)OC1 |
| InChI | InChI=1S/C18H24F2O2/c1-3-5-6-7-13-8-10-15(22-12-13)14-9-11-16(21-4-2)18(20)17(14)19/h3,5,9,11,13,15H,4,6-8,10,12H2,1-2H3/b5-3+ |
| InChIKey | RFUWRZFDSNZYGH-HWKANZROSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|