C37H48F6O3 — CID 134273710
5-[6-(difluoromethylidene)-11-[6-(2,3-difluoro-4-methylphenyl)oxan-3-yl]undecyl]-2-(4-ethoxy-2,3-difluorophenyl)oxane (PubChem CID 134273710) has the molecular formula C37H48F6O3 and a molecular weight of 654.78 g/mol. Its IUPAC name is 5-[6-(difluoromethylidene)-11-[6-(2,3-difluoro-4-methylphenyl)oxan-3-yl]undecyl]-2-(4-ethoxy-2,3-difluorophenyl)oxane.
| Compound Name | 5-[6-(difluoromethylidene)-11-[6-(2,3-difluoro-4-methylphenyl)oxan-3-yl]undecyl]-2-(4-ethoxy-2,3-difluorophenyl)oxane |
|---|---|
| PubChem CID | 134273710 |
| Molecular Formula | C37H48F6O3 |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | 5-[6-(difluoromethylidene)-11-[6-(2,3-difluoro-4-methylphenyl)oxan-3-yl]undecyl]-2-(4-ethoxy-2,3-difluorophenyl)oxane |
| SMILES | CCOc1ccc(C2CCC(CCCCCC(CCCCCC3CCC(c4ccc(C)c(F)c4F)OC3)=C(F)F)CO2)c(F)c1F |
| InChI | InChI=1S/C37H48F6O3/c1-3-44-32-21-18-29(35(40)36(32)41)31-20-16-26(23-46-31)11-7-5-9-13-27(37(42)43)12-8-4-6-10-25-15-19-30(45-22-25)28-17-14-24(2)33(38)34(28)39/h14,17-18,21,25-26,30-31H,3-13,15-16,19-20,22-23H2,1-2H3 |
| InChIKey | AWKWGBDDQMNXQU-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|