C26H31F3O3 — CID 123272971
2-[4-[(4-ethoxy-2,3-difluorophenoxy)methyl]phenyl]-5-(5-fluorohex-4-enyl)oxane (PubChem CID 123272971) has the molecular formula C26H31F3O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-[4-[(4-ethoxy-2,3-difluorophenoxy)methyl]phenyl]-5-(5-fluorohex-4-enyl)oxane.
| Compound Name | 2-[4-[(4-ethoxy-2,3-difluorophenoxy)methyl]phenyl]-5-(5-fluorohex-4-enyl)oxane |
|---|---|
| PubChem CID | 123272971 |
| Molecular Formula | C26H31F3O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[4-[(4-ethoxy-2,3-difluorophenoxy)methyl]phenyl]-5-(5-fluorohex-4-enyl)oxane |
| SMILES | CCOc1ccc(OCc2ccc(C3CCC(CCCC=C(C)F)CO3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H31F3O3/c1-3-30-23-14-15-24(26(29)25(23)28)32-17-20-8-11-21(12-9-20)22-13-10-19(16-31-22)7-5-4-6-18(2)27/h6,8-9,11-12,14-15,19,22H,3-5,7,10,13,16-17H2,1-2H3 |
| InChIKey | RNCJWSSHEMAUTM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|