C27H31F3O3 — CID 123349918
(4-ethoxy-2,3-difluorophenyl) 4-[4-(5-fluorohex-4-enyl)cyclohexyl]benzoate (PubChem CID 123349918) has the molecular formula C27H31F3O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is (4-ethoxy-2,3-difluorophenyl) 4-[4-(5-fluorohex-4-enyl)cyclohexyl]benzoate.
| Compound Name | (4-ethoxy-2,3-difluorophenyl) 4-[4-(5-fluorohex-4-enyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 123349918 |
| Molecular Formula | C27H31F3O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (4-ethoxy-2,3-difluorophenyl) 4-[4-(5-fluorohex-4-enyl)cyclohexyl]benzoate |
| SMILES | CCOc1ccc(OC(=O)c2ccc(C3CCC(CCCC=C(C)F)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H31F3O3/c1-3-32-23-16-17-24(26(30)25(23)29)33-27(31)22-14-12-21(13-15-22)20-10-8-19(9-11-20)7-5-4-6-18(2)28/h6,12-17,19-20H,3-5,7-11H2,1-2H3 |
| InChIKey | APQLFDQVCWHLKR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|