C21H22F3NO2 — CID 23190581
(2,5,6-trifluoro-3-pyridinyl) 4-(4-propylcyclohexyl)benzoate (PubChem CID 23190581) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is (2,5,6-trifluoro-3-pyridinyl) 4-(4-propylcyclohexyl)benzoate.
| Compound Name | (2,5,6-trifluoro-3-pyridinyl) 4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 23190581 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2,5,6-trifluoro-3-pyridinyl) 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3cc(F)c(F)nc3F)cc2)CC1 |
| InChI | InChI=1S/C21H22F3NO2/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)21(26)27-18-12-17(22)19(23)25-20(18)24/h8-14H,2-7H2,1H3 |
| InChIKey | TUFHIBZHYMITKV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|