C22H25F2NO2 — CID 19765607
(2,6-difluoro-3-pyridinyl) 4-(4-butylcyclohexyl)benzoate (PubChem CID 19765607) has the molecular formula C22H25F2NO2 and a molecular weight of 373.44 g/mol. Its IUPAC name is (2,6-difluoro-3-pyridinyl) 4-(4-butylcyclohexyl)benzoate.
| Compound Name | (2,6-difluoro-3-pyridinyl) 4-(4-butylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 19765607 |
| Molecular Formula | C22H25F2NO2 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (2,6-difluoro-3-pyridinyl) 4-(4-butylcyclohexyl)benzoate |
| SMILES | CCCCC1CCC(c2ccc(C(=O)Oc3ccc(F)nc3F)cc2)CC1 |
| InChI | InChI=1S/C22H25F2NO2/c1-2-3-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)22(26)27-19-13-14-20(23)25-21(19)24/h9-16H,2-8H2,1H3 |
| InChIKey | FOBNRVJVJRBZOX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|