C28H28F4O3 — CID 139855697
[5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate (PubChem CID 139855697) has the molecular formula C28H28F4O3 and a molecular weight of 488.52 g/mol. Its IUPAC name is [5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate.
| Compound Name | [5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 139855697 |
| Molecular Formula | C28H28F4O3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [5-fluoro-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc4c(F)c(OCC(F)(F)F)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C28H28F4O3/c1-2-3-18-4-6-19(7-5-18)20-8-10-21(11-9-20)27(33)35-23-13-14-24-22(16-23)12-15-25(26(24)29)34-17-28(30,31)32/h8-16,18-19H,2-7,17H2,1H3 |
| InChIKey | QSDDTPORULUYQH-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|