C26H24F4O3 — CID 139856096
[5-fluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate (PubChem CID 139856096) has the molecular formula C26H24F4O3 and a molecular weight of 460.47 g/mol. Its IUPAC name is [5-fluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate.
| Compound Name | [5-fluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate |
|---|---|
| PubChem CID | 139856096 |
| Molecular Formula | C26H24F4O3 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [5-fluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate |
| SMILES | CCOC1CCC(c2ccc(C(=O)Oc3ccc4c(F)c(C(F)(F)F)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C26H24F4O3/c1-2-32-20-10-7-17(8-11-20)16-3-5-18(6-4-16)25(31)33-21-12-13-22-19(15-21)9-14-23(24(22)27)26(28,29)30/h3-6,9,12-15,17,20H,2,7-8,10-11H2,1H3 |
| InChIKey | FNNUOCOLCQKKHB-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|