About [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate
[6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate (PubChem CID 139856192) has the molecular formula C27H25F3O3
and a molecular weight of 454.49 g/mol. Its IUPAC name is [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate.
Molecular Properties
| Compound Name | [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate |
| PubChem CID | 139856192 |
| Molecular Formula | C27H25F3O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate |
| SMILES | CCOC1CCC(c2ccc(C(=O)Oc3ccc4c(F)c(C=C(F)F)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C27H25F3O3/c1-2-32-22-11-9-18(10-12-22)17-3-5-19(6-4-17)27(31)33-23-13-14-24-20(15-23)7-8-21(26(24)30)16-25(28)29/h3-8,13-16,18,22H,2,9-12H2,1H3 |
| InChIKey | NKZMNCCGFXZTJH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate?
The IUPAC name of [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate (CID 139856192) is [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate.
What is the SMILES notation for [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate?
The canonical SMILES for [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate is CCOC1CCC(c2ccc(C(=O)Oc3ccc4c(F)c(C=C(F)F)ccc4c3)cc2)CC1.
What is the InChIKey of [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate?
The InChIKey is NKZMNCCGFXZTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25F3O3/c1-2-32-22-11-9-18(10-12-22)17-3-5-19(6-4-17)27(31)33-23-13-14-24-20(15-23)7-8-21(26(24)30)16-25(28)29/h3-8,13-16,18,22H,2,9-12H2,1H3.
What are the key properties of [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate?
[6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate has a molecular weight of 454.49 g/mol, XLogP of 7.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-ethoxycyclohexyl)benzoate is sourced from PubChem (CID 139856192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).