C26H23F3 — CID 139856505
2-(2,2-difluoroethenyl)-6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoronaphthalene (PubChem CID 139856505) has the molecular formula C26H23F3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoronaphthalene.
| Compound Name | 2-(2,2-difluoroethenyl)-6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139856505 |
| Molecular Formula | C26H23F3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoronaphthalene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc4c(F)c(C=C(F)F)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C26H23F3/c1-2-17-3-5-18(6-4-17)19-7-9-20(10-8-19)21-13-14-24-22(15-21)11-12-23(26(24)29)16-25(27)28/h2,7-18H,1,3-6H2 |
| InChIKey | KAKXUSNGZZAVSZ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|