C29H31F — CID 139860851
6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoro-2-[(E)-pent-3-enyl]naphthalene (PubChem CID 139860851) has the molecular formula C29H31F and a molecular weight of 398.57 g/mol. Its IUPAC name is 6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoro-2-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoro-2-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 139860851 |
| Molecular Formula | C29H31F |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 6-[4-(4-ethenylcyclohexyl)phenyl]-1-fluoro-2-[(E)-pent-3-enyl]naphthalene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc4c(F)c(CC/C=C/C)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C29H31F/c1-3-5-6-7-25-16-17-27-20-26(18-19-28(27)29(25)30)24-14-12-23(13-15-24)22-10-8-21(4-2)9-11-22/h3-5,12-22H,2,6-11H2,1H3/b5-3+ |
| InChIKey | NFHZRJLUEQEUKP-HWKANZROSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|