C28H27F3O2 — CID 139856283
[6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate (PubChem CID 139856283) has the molecular formula C28H27F3O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate.
| Compound Name | [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 139856283 |
| Molecular Formula | C28H27F3O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [6-(2,2-difluoroethenyl)-5-fluoronaphthalen-2-yl] 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc4c(F)c(C=C(F)F)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C28H27F3O2/c1-2-3-18-4-6-19(7-5-18)20-8-10-21(11-9-20)28(32)33-24-14-15-25-22(16-24)12-13-23(27(25)31)17-26(29)30/h8-19H,2-7H2,1H3 |
| InChIKey | IDQIKHOSRXRQNG-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|