C27H36O3S — CID 173376394
(4-sulfanylphenyl) 4-(4-octoxycyclohexyl)benzoate (PubChem CID 173376394) has the molecular formula C27H36O3S and a molecular weight of 440.65 g/mol. Its IUPAC name is (4-sulfanylphenyl) 4-(4-octoxycyclohexyl)benzoate.
| Compound Name | (4-sulfanylphenyl) 4-(4-octoxycyclohexyl)benzoate |
|---|---|
| PubChem CID | 173376394 |
| Molecular Formula | C27H36O3S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | (4-sulfanylphenyl) 4-(4-octoxycyclohexyl)benzoate |
| SMILES | CCCCCCCCOC1CCC(c2ccc(C(=O)Oc3ccc(S)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H36O3S/c1-2-3-4-5-6-7-20-29-24-14-12-22(13-15-24)21-8-10-23(11-9-21)27(28)30-25-16-18-26(31)19-17-25/h8-11,16-19,22,24,31H,2-7,12-15,20H2,1H3 |
| InChIKey | GLROGRJZCXWNSV-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|