C22H25F5O3S — CID 88523492
[4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(4-propoxycyclohexyl)benzoate (PubChem CID 88523492) has the molecular formula C22H25F5O3S and a molecular weight of 464.50 g/mol. Its IUPAC name is [4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(4-propoxycyclohexyl)benzoate.
| Compound Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(4-propoxycyclohexyl)benzoate |
|---|---|
| PubChem CID | 88523492 |
| Molecular Formula | C22H25F5O3S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(4-propoxycyclohexyl)benzoate |
| SMILES | CCCOC1CCC(c2ccc(C(=O)Oc3ccc(S(F)(F)(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H25F5O3S/c1-2-15-29-19-9-7-17(8-10-19)16-3-5-18(6-4-16)22(28)30-20-11-13-21(14-12-20)31(23,24,25,26)27/h3-6,11-14,17,19H,2,7-10,15H2,1H3 |
| InChIKey | VWOFLDKBONPXGY-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|