C44H49FO8 — CID 18979607
[4-fluoro-2-[4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoyl]oxyphenyl] 4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoate (PubChem CID 18979607) has the molecular formula C44H49FO8 and a molecular weight of 724.87 g/mol. Its IUPAC name is [4-fluoro-2-[4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoyl]oxyphenyl] 4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoate.
| Compound Name | [4-fluoro-2-[4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoyl]oxyphenyl] 4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 18979607 |
| Molecular Formula | C44H49FO8 |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.34 |
| IUPAC Name | [4-fluoro-2-[4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoyl]oxyphenyl] 4-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]benzoate |
| SMILES | C=CC(=O)OCCCC1CCC(c2ccc(C(=O)Oc3ccc(F)cc3OC(=O)c3ccc(C4CCC(CCCOC(=O)C=C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C44H49FO8/c1-3-41(46)50-27-5-7-30-9-13-32(14-10-30)34-17-21-36(22-18-34)43(48)52-39-26-25-38(45)29-40(39)53-44(49)37-23-19-35(20-24-37)33-15-11-31(12-16-33)8-6-28-51-42(47)4-2/h3-4,17-26,29-33H,1-2,5-16,27-28H2 |
| InChIKey | QTSRHKZINUNPOI-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|