C28H31NO4 — CID 67676741
(2-cyanophenyl) 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]benzoate (PubChem CID 67676741) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2-cyanophenyl) 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]benzoate.
| Compound Name | (2-cyanophenyl) 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]benzoate |
|---|---|
| PubChem CID | 67676741 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (2-cyanophenyl) 4-[2-[4-(3-prop-2-enoyloxypropyl)cyclohexyl]ethyl]benzoate |
| SMILES | C=CC(=O)OCCCC1CCC(CCc2ccc(C(=O)Oc3ccccc3C#N)cc2)CC1 |
| InChI | InChI=1S/C28H31NO4/c1-2-27(30)32-19-5-6-21-9-11-22(12-10-21)13-14-23-15-17-24(18-16-23)28(31)33-26-8-4-3-7-25(26)20-29/h2-4,7-8,15-18,21-22H,1,5-6,9-14,19H2 |
| InChIKey | UDIFWPDIJWNDHQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|